Organic acids and derivatives
Filtered Search Results
3,3-Dimethylallyl acetate, 98%, stab. with 0.1% alpha tocopherol, Thermo Scientific Chemicals
CAS: 1191-16-8 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00036569 InChI Key: XXIKYCPRDXIMQM-UHFFFAOYSA-N Synonym: prenyl acetate,3,3-dimethylallyl acetate,3-methyl-2-butenyl acetate,isopent-2-enyl acetate,3-methylbut-2-en-1-yl acetate,dimethylallyl acetate,2-buten-1-ol, 3-methyl-, acetate,3-methyl-2-buten-1-ol, acetate,unii-i7kov03hgs,isopentenyl acetate PubChem CID: 14489 IUPAC Name: 3-methylbut-2-enyl acetate SMILES: CC(C)=CCOC(C)=O
| PubChem CID | 14489 |
|---|---|
| CAS | 1191-16-8 |
| Molecular Weight (g/mol) | 128.17 |
| MDL Number | MFCD00036569 |
| SMILES | CC(C)=CCOC(C)=O |
| Synonym | prenyl acetate,3,3-dimethylallyl acetate,3-methyl-2-butenyl acetate,isopent-2-enyl acetate,3-methylbut-2-en-1-yl acetate,dimethylallyl acetate,2-buten-1-ol, 3-methyl-, acetate,3-methyl-2-buten-1-ol, acetate,unii-i7kov03hgs,isopentenyl acetate |
| IUPAC Name | 3-methylbut-2-enyl acetate |
| InChI Key | XXIKYCPRDXIMQM-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Calcium formate, 98%
CAS: 544-17-2 Molecular Formula: C2H2CaO4 Molecular Weight (g/mol): 130.112 MDL Number: MFCD00036108 InChI Key: CBOCVOKPQGJKKJ-UHFFFAOYSA-L Synonym: calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 PubChem CID: 10997 ChEBI: CHEBI:81851 IUPAC Name: calcium;diformate SMILES: C(=O)[O-].C(=O)[O-].[Ca+2]
| PubChem CID | 10997 |
|---|---|
| CAS | 544-17-2 |
| Molecular Weight (g/mol) | 130.112 |
| ChEBI | CHEBI:81851 |
| MDL Number | MFCD00036108 |
| SMILES | C(=O)[O-].C(=O)[O-].[Ca+2] |
| Synonym | calcium formate,calcium diformate,formic acid, calcium salt,calcoform,unii-np3jd65npy,mravencan vapenaty czech,calcium formate ca hco2 2,formic acid calcium salt,np3jd65npy,formic acid, calcium salt 2:1 |
| IUPAC Name | calcium;diformate |
| InChI Key | CBOCVOKPQGJKKJ-UHFFFAOYSA-L |
| Molecular Formula | C2H2CaO4 |
Methyl pyruvate, 98%
CAS: 600-22-6 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.089 MDL Number: MFCD00008754 InChI Key: CWKLZLBVOJRSOM-UHFFFAOYSA-N Synonym: methyl pyruvate,pyruvic acid, methyl ester,pyruvic acid methyl ester,methyl 2-oxopropionate,propanoic acid, 2-oxo-, methyl ester,methyl-pyruvate,methylglyoxylic acid methyl ester,unii-3kjm65g5xl,3kjm65g5xl,2-oxo-propionic acid methyl ester PubChem CID: 11748 ChEBI: CHEBI:51850 IUPAC Name: methyl 2-oxopropanoate SMILES: CC(=O)C(=O)OC
| PubChem CID | 11748 |
|---|---|
| CAS | 600-22-6 |
| Molecular Weight (g/mol) | 102.089 |
| ChEBI | CHEBI:51850 |
| MDL Number | MFCD00008754 |
| SMILES | CC(=O)C(=O)OC |
| Synonym | methyl pyruvate,pyruvic acid, methyl ester,pyruvic acid methyl ester,methyl 2-oxopropionate,propanoic acid, 2-oxo-, methyl ester,methyl-pyruvate,methylglyoxylic acid methyl ester,unii-3kjm65g5xl,3kjm65g5xl,2-oxo-propionic acid methyl ester |
| IUPAC Name | methyl 2-oxopropanoate |
| InChI Key | CWKLZLBVOJRSOM-UHFFFAOYSA-N |
| Molecular Formula | C4H6O3 |
Methyl 3-aminobenzoate, 98%
CAS: 4518-10-9 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00017102 InChI Key: VZDNXXPBYLGWOS-UHFFFAOYSA-N Synonym: benzoic acid, 3-amino-, methyl ester,methyl-3-aminobenzoate,3-aminobenzoic acid methyl ester,m-aminobenzoic acid, methyl ester,3-amino-benzoic acid methyl ester,methyl m-aminobenzoate,methyl3-aminobenzoate,methyl-m-aminobenzoate,pubchem16709,acmc-1aeif PubChem CID: 78274 IUPAC Name: methyl 3-aminobenzoate SMILES: COC(=O)C1=CC(=CC=C1)N
| PubChem CID | 78274 |
|---|---|
| CAS | 4518-10-9 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00017102 |
| SMILES | COC(=O)C1=CC(=CC=C1)N |
| Synonym | benzoic acid, 3-amino-, methyl ester,methyl-3-aminobenzoate,3-aminobenzoic acid methyl ester,m-aminobenzoic acid, methyl ester,3-amino-benzoic acid methyl ester,methyl m-aminobenzoate,methyl3-aminobenzoate,methyl-m-aminobenzoate,pubchem16709,acmc-1aeif |
| IUPAC Name | methyl 3-aminobenzoate |
| InChI Key | VZDNXXPBYLGWOS-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Diethyl 4-methylbenzylphosphonate, 98+%
CAS: 3762-25-2 Molecular Formula: C12H19O3P Molecular Weight (g/mol): 242.255 MDL Number: MFCD00041385 InChI Key: QKGBKPZAXXBLJE-UHFFFAOYSA-N Synonym: diethyl 4-methylbenzylphosphonate,diethyl 4-methylbenzyl phosphonate,4-methylbenzyl phosphonic acid diethyl ester,diethyl 4-methylphenyl methylphosphonate,diethoxy 4-methylphenyl methyl phosphino-1-one,acmc-209iuf,diethyl-4-methylbenzylphosphonate,1-diethoxyphosphorylmethyl-4-methylbenzene,phosphonic acid, 4-methylphenyl methyl-, diethyl ester PubChem CID: 3050 IUPAC Name: 1-(diethoxyphosphorylmethyl)-4-methylbenzene SMILES: CCOP(=O)(CC1=CC=C(C=C1)C)OCC
| PubChem CID | 3050 |
|---|---|
| CAS | 3762-25-2 |
| Molecular Weight (g/mol) | 242.255 |
| MDL Number | MFCD00041385 |
| SMILES | CCOP(=O)(CC1=CC=C(C=C1)C)OCC |
| Synonym | diethyl 4-methylbenzylphosphonate,diethyl 4-methylbenzyl phosphonate,4-methylbenzyl phosphonic acid diethyl ester,diethyl 4-methylphenyl methylphosphonate,diethoxy 4-methylphenyl methyl phosphino-1-one,acmc-209iuf,diethyl-4-methylbenzylphosphonate,1-diethoxyphosphorylmethyl-4-methylbenzene,phosphonic acid, 4-methylphenyl methyl-, diethyl ester |
| IUPAC Name | 1-(diethoxyphosphorylmethyl)-4-methylbenzene |
| InChI Key | QKGBKPZAXXBLJE-UHFFFAOYSA-N |
| Molecular Formula | C12H19O3P |
cis-Aconitic acid, tech. 85%
CAS: 585-84-2 Molecular Formula: C6H6O6 Molecular Weight (g/mol): 174.11 MDL Number: MFCD00063184 InChI Key: GTZCVFVGUGFEME-HNQUOIGGSA-N Synonym: cis-aconitic acid,cis-aconitate,achilleic acid,citridinic acid,equisetic acid,pyrocitric acid,achilleaic acid,citridic acid,cis-aconic acid,aconitic acid PubChem CID: 643757 ChEBI: CHEBI:32805 SMILES: OC(=O)C\C(=C/C(O)=O)C(O)=O
| PubChem CID | 643757 |
|---|---|
| CAS | 585-84-2 |
| Molecular Weight (g/mol) | 174.11 |
| ChEBI | CHEBI:32805 |
| MDL Number | MFCD00063184 |
| SMILES | OC(=O)C\C(=C/C(O)=O)C(O)=O |
| Synonym | cis-aconitic acid,cis-aconitate,achilleic acid,citridinic acid,equisetic acid,pyrocitric acid,achilleaic acid,citridic acid,cis-aconic acid,aconitic acid |
| InChI Key | GTZCVFVGUGFEME-HNQUOIGGSA-N |
| Molecular Formula | C6H6O6 |
Methyl trifluoroacetate, 98+%
CAS: 431-47-0 Molecular Formula: C3H3F3O2 Molecular Weight (g/mol): 128.05 MDL Number: MFCD00000417 InChI Key: VMVNZNXAVJHNDJ-UHFFFAOYSA-N Synonym: methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 PubChem CID: 9893 IUPAC Name: methyl 2,2,2-trifluoroacetate SMILES: COC(=O)C(F)(F)F
| PubChem CID | 9893 |
|---|---|
| CAS | 431-47-0 |
| Molecular Weight (g/mol) | 128.05 |
| MDL Number | MFCD00000417 |
| SMILES | COC(=O)C(F)(F)F |
| Synonym | methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 |
| IUPAC Name | methyl 2,2,2-trifluoroacetate |
| InChI Key | VMVNZNXAVJHNDJ-UHFFFAOYSA-N |
| Molecular Formula | C3H3F3O2 |
(+)-Dimethyl 2,3-O-isopropylidene-D-tartrate, 97%
CAS: 37031-30-4 Molecular Formula: C9H14O6 Molecular Weight (g/mol): 218.21 MDL Number: MFCD00040504 InChI Key: ROZOUYVVWUTPNG-WDSKDSINSA-N Synonym: 4s,5s-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid dimethyl ester,+-dimethyl 2,3-o-isopropylidene-d-tartrate,dimethyl 4s,5s-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate,4s,5s-dimethyl 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate,4,5-dimethyl 4s,5s-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate,pubchem6765,dimethyl--2,3-o-isopropylidene-l-tartrate,dimethyl 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate #,+-dimethyl-2,3-o-isopropylidine-d-tartrate,dimethyl +-2,3-o-isopropylidene-d-tartrate PubChem CID: 688156 IUPAC Name: dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate SMILES: CC1(OC(C(O1)C(=O)OC)C(=O)OC)C
| PubChem CID | 688156 |
|---|---|
| CAS | 37031-30-4 |
| Molecular Weight (g/mol) | 218.21 |
| MDL Number | MFCD00040504 |
| SMILES | CC1(OC(C(O1)C(=O)OC)C(=O)OC)C |
| Synonym | 4s,5s-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid dimethyl ester,+-dimethyl 2,3-o-isopropylidene-d-tartrate,dimethyl 4s,5s-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate,4s,5s-dimethyl 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate,4,5-dimethyl 4s,5s-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate,pubchem6765,dimethyl--2,3-o-isopropylidene-l-tartrate,dimethyl 2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate #,+-dimethyl-2,3-o-isopropylidine-d-tartrate,dimethyl +-2,3-o-isopropylidene-d-tartrate |
| IUPAC Name | dimethyl (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylate |
| InChI Key | ROZOUYVVWUTPNG-WDSKDSINSA-N |
| Molecular Formula | C9H14O6 |
Ethyl 4-pentenoate, 98+%
CAS: 1968-40-7 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.171 MDL Number: MFCD00036562 InChI Key: PTVSRINJXWDIKP-UHFFFAOYSA-N Synonym: ethyl 4-pentenoate,4-pentenoic acid ethyl ester,4-pentenoic acid, ethyl ester,ethyl pent-4-en-1-oate,unii-210um0f8jp,4-ethoxycarbonylbut-1-ene,pent-4-enoic acid ethyl ester,ethyl allylacetate,ethyl 4-pentenate,ethylpent-4-enoate PubChem CID: 74786 IUPAC Name: ethyl pent-4-enoate SMILES: CCOC(=O)CCC=C
| PubChem CID | 74786 |
|---|---|
| CAS | 1968-40-7 |
| Molecular Weight (g/mol) | 128.171 |
| MDL Number | MFCD00036562 |
| SMILES | CCOC(=O)CCC=C |
| Synonym | ethyl 4-pentenoate,4-pentenoic acid ethyl ester,4-pentenoic acid, ethyl ester,ethyl pent-4-en-1-oate,unii-210um0f8jp,4-ethoxycarbonylbut-1-ene,pent-4-enoic acid ethyl ester,ethyl allylacetate,ethyl 4-pentenate,ethylpent-4-enoate |
| IUPAC Name | ethyl pent-4-enoate |
| InChI Key | PTVSRINJXWDIKP-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
1H-Imidazole-2-carboxylic acid, 97%, Thermo Scientific™
CAS: 16042-25-4 Molecular Formula: C4H4N2O2 Molecular Weight (g/mol): 112.088 InChI Key: KYWMCFOWDYFYLV-UHFFFAOYSA-N Synonym: 2-imidazolecarboxylic acid,imidazole-2-carboxylic acid,unii-o9g6515vc1,1h-imidazolecarboxylic acid,2-imidazolecarboxylicacid,2-imidazocarboxylic acid,1h-imidazole-2-carboxylicacid,imidazolecarboxylic,acmc-1avrt,2-carboxy-1h-imidazole PubChem CID: 574321 IUPAC Name: 1H-imidazole-2-carboxylic acid SMILES: C1=CN=C(N1)C(=O)O
| PubChem CID | 574321 |
|---|---|
| CAS | 16042-25-4 |
| Molecular Weight (g/mol) | 112.088 |
| SMILES | C1=CN=C(N1)C(=O)O |
| Synonym | 2-imidazolecarboxylic acid,imidazole-2-carboxylic acid,unii-o9g6515vc1,1h-imidazolecarboxylic acid,2-imidazolecarboxylicacid,2-imidazocarboxylic acid,1h-imidazole-2-carboxylicacid,imidazolecarboxylic,acmc-1avrt,2-carboxy-1h-imidazole |
| IUPAC Name | 1H-imidazole-2-carboxylic acid |
| InChI Key | KYWMCFOWDYFYLV-UHFFFAOYSA-N |
| Molecular Formula | C4H4N2O2 |
(+)-Diisopropyl L-tartrate, 97%
CAS: 2217-15-4 Molecular Formula: C10H18O6 Molecular Weight (g/mol): 234.248 MDL Number: MFCD00064450 InChI Key: XEBCWEDRGPSHQH-HTQZYQBOSA-N Synonym: +-diisopropyl l-tartrate,2r,3r-diisopropyl 2,3-dihydroxysuccinate,di-isopropyl tartrate,diisoprropyl-l-tartrate,+-dipt,l-+-tartaric acid diisopropyl ester,diisopropyl l-tartrate,l-+-diisopropyl-tartrate, l-dipt,butanedioic acid, 2,3-dihydroxy-, bis 1-methylethyl ester, r,r-+/-,1,4-diisopropyl 2r,3r-2,3-dihydroxybutanedioate PubChem CID: 6453580 IUPAC Name: dipropan-2-yl (2R,3R)-2,3-dihydroxybutanedioate SMILES: CC(C)OC(=O)C(C(C(=O)OC(C)C)O)O
| PubChem CID | 6453580 |
|---|---|
| CAS | 2217-15-4 |
| Molecular Weight (g/mol) | 234.248 |
| MDL Number | MFCD00064450 |
| SMILES | CC(C)OC(=O)C(C(C(=O)OC(C)C)O)O |
| Synonym | +-diisopropyl l-tartrate,2r,3r-diisopropyl 2,3-dihydroxysuccinate,di-isopropyl tartrate,diisoprropyl-l-tartrate,+-dipt,l-+-tartaric acid diisopropyl ester,diisopropyl l-tartrate,l-+-diisopropyl-tartrate, l-dipt,butanedioic acid, 2,3-dihydroxy-, bis 1-methylethyl ester, r,r-+/-,1,4-diisopropyl 2r,3r-2,3-dihydroxybutanedioate |
| IUPAC Name | dipropan-2-yl (2R,3R)-2,3-dihydroxybutanedioate |
| InChI Key | XEBCWEDRGPSHQH-HTQZYQBOSA-N |
| Molecular Formula | C10H18O6 |
Ethyl 3-hexenoate, 98%
CAS: 2396-83-0 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD00036524 InChI Key: VTSFIPHRNAESED-AATRIKPKSA-N Synonym: ethyl 3-hexenoate,3-hexenoic acid, ethyl ester,ethyl hex-3-enoate,ethyl e-hex-3-enoate,3-hexenoic acid, ethyl ester, e,ethyl trans-3-hexenoate,ethyl e-3-hexenoate,e-3-hexenoic acid ethyl ester,ethyl hydrosorbate,3-hexenoic acid, ethyl ester, 3e PubChem CID: 5362622 IUPAC Name: ethyl (E)-hex-3-enoate SMILES: CCOC(=O)C\C=C\CC
| PubChem CID | 5362622 |
|---|---|
| CAS | 2396-83-0 |
| Molecular Weight (g/mol) | 142.20 |
| MDL Number | MFCD00036524 |
| SMILES | CCOC(=O)C\C=C\CC |
| Synonym | ethyl 3-hexenoate,3-hexenoic acid, ethyl ester,ethyl hex-3-enoate,ethyl e-hex-3-enoate,3-hexenoic acid, ethyl ester, e,ethyl trans-3-hexenoate,ethyl e-3-hexenoate,e-3-hexenoic acid ethyl ester,ethyl hydrosorbate,3-hexenoic acid, ethyl ester, 3e |
| IUPAC Name | ethyl (E)-hex-3-enoate |
| InChI Key | VTSFIPHRNAESED-AATRIKPKSA-N |
| Molecular Formula | C8H14O2 |
Methyl glycolate, 98%
CAS: 96-35-5 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.078 MDL Number: MFCD00004667 InChI Key: GSJFXBNYJCXDGI-UHFFFAOYSA-N Synonym: methyl glycolate,methyl hydroxyacetate,acetic acid, hydroxy-, methyl ester,glycolic acid, methyl ester,acetic acid, 2-hydroxy-, methyl ester,glycolic acid methyl ester,unii-7g7r729ej0,hydroxyacetic acid methyl ester,glycolic acid methyl,methyl2-hydroxyethanoate PubChem CID: 66774 IUPAC Name: methyl 2-hydroxyacetate SMILES: COC(=O)CO
| PubChem CID | 66774 |
|---|---|
| CAS | 96-35-5 |
| Molecular Weight (g/mol) | 90.078 |
| MDL Number | MFCD00004667 |
| SMILES | COC(=O)CO |
| Synonym | methyl glycolate,methyl hydroxyacetate,acetic acid, hydroxy-, methyl ester,glycolic acid, methyl ester,acetic acid, 2-hydroxy-, methyl ester,glycolic acid methyl ester,unii-7g7r729ej0,hydroxyacetic acid methyl ester,glycolic acid methyl,methyl2-hydroxyethanoate |
| IUPAC Name | methyl 2-hydroxyacetate |
| InChI Key | GSJFXBNYJCXDGI-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
| CAS | 5720-05-8 |
|---|
Methyl oxalyl chloride, 97%
CAS: 5781-53-3 Molecular Formula: C3H3ClO3 Molecular Weight (g/mol): 122.504 MDL Number: MFCD00000705 InChI Key: ZXUQEPZWVQIOJE-UHFFFAOYSA-N Synonym: methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate PubChem CID: 79846 IUPAC Name: methyl 2-chloro-2-oxoacetate SMILES: COC(=O)C(=O)Cl
| PubChem CID | 79846 |
|---|---|
| CAS | 5781-53-3 |
| Molecular Weight (g/mol) | 122.504 |
| MDL Number | MFCD00000705 |
| SMILES | COC(=O)C(=O)Cl |
| Synonym | methyl oxalyl chloride,methyl chloroglyoxylate,methyl chlorooxoacetate,chloroglyoxylic acid methyl ester,acetic acid, chlorooxo-, methyl ester,methyl chlorocarbonyl formate,methyloxalylchloride,methyl chloro oxo acetate,methylchlorooxoacetate,methyl 2-chloro-2-oxo-acetate |
| IUPAC Name | methyl 2-chloro-2-oxoacetate |
| InChI Key | ZXUQEPZWVQIOJE-UHFFFAOYSA-N |
| Molecular Formula | C3H3ClO3 |